C18H24N4O3 — CID 97021453
2-[4-[(1R)-1-hydroxyethyl]triazol-1-yl]-1-[4-(phenoxymethyl)piperidin-1-yl]ethanone (PubChem CID 97021453) has the molecular formula C18H24N4O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-[4-[(1R)-1-hydroxyethyl]triazol-1-yl]-1-[4-(phenoxymethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-[4-[(1R)-1-hydroxyethyl]triazol-1-yl]-1-[4-(phenoxymethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 97021453 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 2-[4-[(1R)-1-hydroxyethyl]triazol-1-yl]-1-[4-(phenoxymethyl)piperidin-1-yl]ethanone |
| SMILES | C[C@@H](O)c1cn(CC(=O)N2CCC(COc3ccccc3)CC2)nn1 |
| InChI | InChI=1S/C18H24N4O3/c1-14(23)17-11-22(20-19-17)12-18(24)21-9-7-15(8-10-21)13-25-16-5-3-2-4-6-16/h2-6,11,14-15,23H,7-10,12-13H2,1H3/t14-/m1/s1 |
| InChIKey | RRNYVMSICHTYPG-CQSZACIVSA-N |
| XLogP | 1.65 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |