C15H20F2N2O3S — CID 97022473
N-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2,4-difluoro-5-methylbenzenesulfonamide (PubChem CID 97022473) has the molecular formula C15H20F2N2O3S and a molecular weight of 346.40 g/mol. Its IUPAC name is N-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2,4-difluoro-5-methylbenzenesulfonamide.
| Compound Name | N-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2,4-difluoro-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 97022473 |
| Molecular Formula | C15H20F2N2O3S |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | N-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2,4-difluoro-5-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC[C@@H]2CN3CCC[C@@H]3CO2)c(F)cc1F |
| InChI | InChI=1S/C15H20F2N2O3S/c1-10-5-15(14(17)6-13(10)16)23(20,21)18-7-12-8-19-4-2-3-11(19)9-22-12/h5-6,11-12,18H,2-4,7-9H2,1H3/t11-,12-/m1/s1 |
| InChIKey | GHJKUMHBHLERJO-VXGBXAGGSA-N |
| XLogP | 1.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |