C16H24N2OS — CID 97023951
(2R,3R)-3-methyl-N-(4-methylsulfanylbutyl)-2-phenylazetidine-1-carboxamide (PubChem CID 97023951) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is (2R,3R)-3-methyl-N-(4-methylsulfanylbutyl)-2-phenylazetidine-1-carboxamide.
| Compound Name | (2R,3R)-3-methyl-N-(4-methylsulfanylbutyl)-2-phenylazetidine-1-carboxamide |
|---|---|
| PubChem CID | 97023951 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (2R,3R)-3-methyl-N-(4-methylsulfanylbutyl)-2-phenylazetidine-1-carboxamide |
| SMILES | CSCCCCNC(=O)N1C[C@@H](C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H24N2OS/c1-13-12-18(15(13)14-8-4-3-5-9-14)16(19)17-10-6-7-11-20-2/h3-5,8-9,13,15H,6-7,10-12H2,1-2H3,(H,17,19)/t13-,15-/m1/s1 |
| InChIKey | DFGAJKPZXJYPPQ-UKRRQHHQSA-N |
| XLogP | 3.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|