C21H34N2O3 — CID 97023983
1-[(3S,5R)-4-(2-methoxyethyl)-3,5-dimethylpiperazin-1-yl]-4-(2-phenylethoxy)butan-1-one (PubChem CID 97023983) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is 1-[(3S,5R)-4-(2-methoxyethyl)-3,5-dimethylpiperazin-1-yl]-4-(2-phenylethoxy)butan-1-one.
| Compound Name | 1-[(3S,5R)-4-(2-methoxyethyl)-3,5-dimethylpiperazin-1-yl]-4-(2-phenylethoxy)butan-1-one |
|---|---|
| PubChem CID | 97023983 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | 1-[(3S,5R)-4-(2-methoxyethyl)-3,5-dimethylpiperazin-1-yl]-4-(2-phenylethoxy)butan-1-one |
| SMILES | COCCN1[C@H](C)CN(C(=O)CCCOCCc2ccccc2)C[C@@H]1C |
| InChI | InChI=1S/C21H34N2O3/c1-18-16-22(17-19(2)23(18)12-15-25-3)21(24)10-7-13-26-14-11-20-8-5-4-6-9-20/h4-6,8-9,18-19H,7,10-17H2,1-3H3/t18-,19+ |
| InChIKey | AJQOOOMTMOFIIQ-KDURUIRLSA-N |
| XLogP | 2.59 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|