C22H23F2N3O — CID 97024925
N-[2-(2,6-difluorophenyl)ethyl]-2-[(1S)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]acetamide (PubChem CID 97024925) has the molecular formula C22H23F2N3O and a molecular weight of 383.44 g/mol. Its IUPAC name is N-[2-(2,6-difluorophenyl)ethyl]-2-[(1S)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]acetamide.
| Compound Name | N-[2-(2,6-difluorophenyl)ethyl]-2-[(1S)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]acetamide |
|---|---|
| PubChem CID | 97024925 |
| Molecular Formula | C22H23F2N3O |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-[2-(2,6-difluorophenyl)ethyl]-2-[(1S)-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]acetamide |
| SMILES | C[C@H]1c2[nH]c3ccccc3c2CCN1CC(=O)NCCc1c(F)cccc1F |
| InChI | InChI=1S/C22H23F2N3O/c1-14-22-16(15-5-2-3-8-20(15)26-22)10-12-27(14)13-21(28)25-11-9-17-18(23)6-4-7-19(17)24/h2-8,14,26H,9-13H2,1H3,(H,25,28)/t14-/m0/s1 |
| InChIKey | HCCPEJMFBJOZQR-AWEZNQCLSA-N |
| XLogP | 3.72 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|