About [(3S)-hept-6-yn-3-yl] (3R)-1-carbamoylpiperidine-3-carboxylate
[(3S)-hept-6-yn-3-yl] (3R)-1-carbamoylpiperidine-3-carboxylate (PubChem CID 97025607) has the molecular formula C14H22N2O3
and a molecular weight of 266.34 g/mol. Its IUPAC name is [(3S)-hept-6-yn-3-yl] (3R)-1-carbamoylpiperidine-3-carboxylate.
Molecular Properties
| Compound Name | [(3S)-hept-6-yn-3-yl] (3R)-1-carbamoylpiperidine-3-carboxylate |
| PubChem CID | 97025607 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | [(3S)-hept-6-yn-3-yl] (3R)-1-carbamoylpiperidine-3-carboxylate |
| SMILES | C#CCC[C@H](CC)OC(=O)[C@@H]1CCCN(C(N)=O)C1 |
| InChI | InChI=1S/C14H22N2O3/c1-3-5-8-12(4-2)19-13(17)11-7-6-9-16(10-11)14(15)18/h1,11-12H,4-10H2,2H3,(H2,15,18)/t11-,12+/m1/s1 |
| InChIKey | PDSYBMIKTZIATL-NEPJUHHUSA-N |
| XLogP | 1.51 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-hept-6-yn-3-yl] (3R)-1-carbamoylpiperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-hept-6-yn-3-yl] (3R)-1-carbamoylpiperidine-3-carboxylate?
The IUPAC name of [(3S)-hept-6-yn-3-yl] (3R)-1-carbamoylpiperidine-3-carboxylate (CID 97025607) is [(3S)-hept-6-yn-3-yl] (3R)-1-carbamoylpiperidine-3-carboxylate.
What is the SMILES notation for [(3S)-hept-6-yn-3-yl] (3R)-1-carbamoylpiperidine-3-carboxylate?
The canonical SMILES for [(3S)-hept-6-yn-3-yl] (3R)-1-carbamoylpiperidine-3-carboxylate is C#CCC[C@H](CC)OC(=O)[C@@H]1CCCN(C(N)=O)C1.
What is the InChIKey of [(3S)-hept-6-yn-3-yl] (3R)-1-carbamoylpiperidine-3-carboxylate?
The InChIKey is PDSYBMIKTZIATL-NEPJUHHUSA-N. The full InChI is InChI=1S/C14H22N2O3/c1-3-5-8-12(4-2)19-13(17)11-7-6-9-16(10-11)14(15)18/h1,11-12H,4-10H2,2H3,(H2,15,18)/t11-,12+/m1/s1.
What are the key properties of [(3S)-hept-6-yn-3-yl] (3R)-1-carbamoylpiperidine-3-carboxylate?
[(3S)-hept-6-yn-3-yl] (3R)-1-carbamoylpiperidine-3-carboxylate has a molecular weight of 266.34 g/mol, XLogP of 1.51, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-hept-6-yn-3-yl] (3R)-1-carbamoylpiperidine-3-carboxylate is sourced from PubChem (CID 97025607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).