C18H17N3O4S — CID 97025860
(2R)-N-[3-(1,3,4-oxadiazol-2-yl)phenyl]sulfonyl-2-phenylbutanamide (PubChem CID 97025860) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is (2R)-N-[3-(1,3,4-oxadiazol-2-yl)phenyl]sulfonyl-2-phenylbutanamide.
| Compound Name | (2R)-N-[3-(1,3,4-oxadiazol-2-yl)phenyl]sulfonyl-2-phenylbutanamide |
|---|---|
| PubChem CID | 97025860 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | (2R)-N-[3-(1,3,4-oxadiazol-2-yl)phenyl]sulfonyl-2-phenylbutanamide |
| SMILES | CC[C@@H](C(=O)NS(=O)(=O)c1cccc(-c2nnco2)c1)c1ccccc1 |
| InChI | InChI=1S/C18H17N3O4S/c1-2-16(13-7-4-3-5-8-13)17(22)21-26(23,24)15-10-6-9-14(11-15)18-20-19-12-25-18/h3-12,16H,2H2,1H3,(H,21,22)/t16-/m1/s1 |
| InChIKey | VPXLKJVRMRKVGF-MRXNPFEDSA-N |
| XLogP | 2.74 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |