C15H15N3O4S — CID 132969952
(E)-3-cyclopropyl-N-[3-(1,3,4-oxadiazol-2-yl)phenyl]sulfonylbut-2-enamide (PubChem CID 132969952) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is (E)-3-cyclopropyl-N-[3-(1,3,4-oxadiazol-2-yl)phenyl]sulfonylbut-2-enamide.
| Compound Name | (E)-3-cyclopropyl-N-[3-(1,3,4-oxadiazol-2-yl)phenyl]sulfonylbut-2-enamide |
|---|---|
| PubChem CID | 132969952 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | (E)-3-cyclopropyl-N-[3-(1,3,4-oxadiazol-2-yl)phenyl]sulfonylbut-2-enamide |
| SMILES | C/C(=C\C(=O)NS(=O)(=O)c1cccc(-c2nnco2)c1)C1CC1 |
| InChI | InChI=1S/C15H15N3O4S/c1-10(11-5-6-11)7-14(19)18-23(20,21)13-4-2-3-12(8-13)15-17-16-9-22-15/h2-4,7-9,11H,5-6H2,1H3,(H,18,19)/b10-7+ |
| InChIKey | TUJNIBLDDSRXFV-JXMROGBWSA-N |
| XLogP | 1.90 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|