C17H21N3O3S — CID 124726979
2-[3-[[(2R,3aR,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]sulfonyl]phenyl]-1,3,4-oxadiazole (PubChem CID 124726979) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-[3-[[(2R,3aR,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]sulfonyl]phenyl]-1,3,4-oxadiazole.
| Compound Name | 2-[3-[[(2R,3aR,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]sulfonyl]phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 124726979 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-[3-[[(2R,3aR,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]sulfonyl]phenyl]-1,3,4-oxadiazole |
| SMILES | C[C@@H]1C[C@H]2CCCC[C@H]2N1S(=O)(=O)c1cccc(-c2nnco2)c1 |
| InChI | InChI=1S/C17H21N3O3S/c1-12-9-13-5-2-3-8-16(13)20(12)24(21,22)15-7-4-6-14(10-15)17-19-18-11-23-17/h4,6-7,10-13,16H,2-3,5,8-9H2,1H3/t12-,13-,16-/m1/s1 |
| InChIKey | CLLLTFJKUIFCCF-XJKCOSOUSA-N |
| XLogP | 3.08 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |