C16H20N4O2 — CID 47033580
1-cycloheptyl-3-[3-(1,3,4-oxadiazol-2-yl)phenyl]urea (PubChem CID 47033580) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-cycloheptyl-3-[3-(1,3,4-oxadiazol-2-yl)phenyl]urea.
| Compound Name | 1-cycloheptyl-3-[3-(1,3,4-oxadiazol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 47033580 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-cycloheptyl-3-[3-(1,3,4-oxadiazol-2-yl)phenyl]urea |
| SMILES | O=C(Nc1cccc(-c2nnco2)c1)NC1CCCCCC1 |
| InChI | InChI=1S/C16H20N4O2/c21-16(18-13-7-3-1-2-4-8-13)19-14-9-5-6-12(10-14)15-20-17-11-22-15/h5-6,9-11,13H,1-4,7-8H2,(H2,18,19,21) |
| InChIKey | HAWOXOLAQAGYBE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |