C13H15N3OS — CID 43511357
N-[3-(1,3,4-oxadiazol-2-yl)phenyl]thian-4-amine (PubChem CID 43511357) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is N-[3-(1,3,4-oxadiazol-2-yl)phenyl]thian-4-amine.
| Compound Name | N-[3-(1,3,4-oxadiazol-2-yl)phenyl]thian-4-amine |
|---|---|
| PubChem CID | 43511357 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | N-[3-(1,3,4-oxadiazol-2-yl)phenyl]thian-4-amine |
| SMILES | c1cc(NC2CCSCC2)cc(-c2nnco2)c1 |
| InChI | InChI=1S/C13H15N3OS/c1-2-10(13-16-14-9-17-13)8-12(3-1)15-11-4-6-18-7-5-11/h1-3,8-9,11,15H,4-7H2 |
| InChIKey | VHFUOTFMDINGRC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |