C15H18N4O2 — CID 43770533
1-[4-[3-(1,3,4-oxadiazol-2-yl)anilino]piperidin-1-yl]ethanone (PubChem CID 43770533) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-[4-[3-(1,3,4-oxadiazol-2-yl)anilino]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[3-(1,3,4-oxadiazol-2-yl)anilino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 43770533 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-[4-[3-(1,3,4-oxadiazol-2-yl)anilino]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(Nc2cccc(-c3nnco3)c2)CC1 |
| InChI | InChI=1S/C15H18N4O2/c1-11(20)19-7-5-13(6-8-19)17-14-4-2-3-12(9-14)15-18-16-10-21-15/h2-4,9-10,13,17H,5-8H2,1H3 |
| InChIKey | DRLJEUUJJVRZLW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |