C25H32N2O3 — CID 97025897
methyl 2-[[(1S)-1-phenylpropyl]-[[3-(piperidine-1-carbonyl)phenyl]methyl]amino]acetate (PubChem CID 97025897) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is methyl 2-[[(1S)-1-phenylpropyl]-[[3-(piperidine-1-carbonyl)phenyl]methyl]amino]acetate.
| Compound Name | methyl 2-[[(1S)-1-phenylpropyl]-[[3-(piperidine-1-carbonyl)phenyl]methyl]amino]acetate |
|---|---|
| PubChem CID | 97025897 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | methyl 2-[[(1S)-1-phenylpropyl]-[[3-(piperidine-1-carbonyl)phenyl]methyl]amino]acetate |
| SMILES | CC[C@@H](c1ccccc1)N(CC(=O)OC)Cc1cccc(C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C25H32N2O3/c1-3-23(21-12-6-4-7-13-21)27(19-24(28)30-2)18-20-11-10-14-22(17-20)25(29)26-15-8-5-9-16-26/h4,6-7,10-14,17,23H,3,5,8-9,15-16,18-19H2,1-2H3/t23-/m0/s1 |
| InChIKey | JUKOEUMADJHRRM-QHCPKHFHSA-N |
| XLogP | 4.44 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |