C16H25N5O — CID 97027681
(1R)-1-(3-butyl-1,2,4-oxadiazol-5-yl)-N-[[(8S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methyl]ethanamine (PubChem CID 97027681) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is (1R)-1-(3-butyl-1,2,4-oxadiazol-5-yl)-N-[[(8S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methyl]ethanamine.
| Compound Name | (1R)-1-(3-butyl-1,2,4-oxadiazol-5-yl)-N-[[(8S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 97027681 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | (1R)-1-(3-butyl-1,2,4-oxadiazol-5-yl)-N-[[(8S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-yl]methyl]ethanamine |
| SMILES | CCCCc1noc([C@@H](C)NC[C@@H]2CCCn3ccnc32)n1 |
| InChI | InChI=1S/C16H25N5O/c1-3-4-7-14-19-16(22-20-14)12(2)18-11-13-6-5-9-21-10-8-17-15(13)21/h8,10,12-13,18H,3-7,9,11H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | LIGPRSGTVCEZKP-OLZOCXBDSA-N |
| XLogP | 2.84 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |