C19H22N4O2 — CID 97027786
(2R)-2-acetamido-2-cyclopentyl-N-(6-phenylpyridazin-3-yl)acetamide (PubChem CID 97027786) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (2R)-2-acetamido-2-cyclopentyl-N-(6-phenylpyridazin-3-yl)acetamide.
| Compound Name | (2R)-2-acetamido-2-cyclopentyl-N-(6-phenylpyridazin-3-yl)acetamide |
|---|---|
| PubChem CID | 97027786 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (2R)-2-acetamido-2-cyclopentyl-N-(6-phenylpyridazin-3-yl)acetamide |
| SMILES | CC(=O)N[C@@H](C(=O)Nc1ccc(-c2ccccc2)nn1)C1CCCC1 |
| InChI | InChI=1S/C19H22N4O2/c1-13(24)20-18(15-9-5-6-10-15)19(25)21-17-12-11-16(22-23-17)14-7-3-2-4-8-14/h2-4,7-8,11-12,15,18H,5-6,9-10H2,1H3,(H,20,24)(H,21,23,25)/t18-/m1/s1 |
| InChIKey | RKNZBGGKQDGZKV-GOSISDBHSA-N |
| XLogP | 2.78 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |