About 2-[[(S)-(3,4-dimethylphenyl)sulfinyl]methyl]-5-thiophen-2-yl-1,3-oxazole
2-[[(S)-(3,4-dimethylphenyl)sulfinyl]methyl]-5-thiophen-2-yl-1,3-oxazole (PubChem CID 97031157) has the molecular formula C16H15NO2S2
and a molecular weight of 317.44 g/mol. Its IUPAC name is 2-[[(S)-(3,4-dimethylphenyl)sulfinyl]methyl]-5-thiophen-2-yl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[[(S)-(3,4-dimethylphenyl)sulfinyl]methyl]-5-thiophen-2-yl-1,3-oxazole |
| PubChem CID | 97031157 |
| Molecular Formula | C16H15NO2S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-[[(S)-(3,4-dimethylphenyl)sulfinyl]methyl]-5-thiophen-2-yl-1,3-oxazole |
| SMILES | Cc1ccc([S@@](=O)Cc2ncc(-c3cccs3)o2)cc1C |
| InChI | InChI=1S/C16H15NO2S2/c1-11-5-6-13(8-12(11)2)21(18)10-16-17-9-14(19-16)15-4-3-7-20-15/h3-9H,10H2,1-2H3/t21-/m0/s1 |
| InChIKey | ZCTUWMMQWLXVMW-NRFANRHFSA-N |
| XLogP | 4.33 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[(S)-(3,4-dimethylphenyl)sulfinyl]methyl]-5-thiophen-2-yl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(S)-(3,4-dimethylphenyl)sulfinyl]methyl]-5-thiophen-2-yl-1,3-oxazole?
The IUPAC name of 2-[[(S)-(3,4-dimethylphenyl)sulfinyl]methyl]-5-thiophen-2-yl-1,3-oxazole (CID 97031157) is 2-[[(S)-(3,4-dimethylphenyl)sulfinyl]methyl]-5-thiophen-2-yl-1,3-oxazole.
What is the SMILES notation for 2-[[(S)-(3,4-dimethylphenyl)sulfinyl]methyl]-5-thiophen-2-yl-1,3-oxazole?
The canonical SMILES for 2-[[(S)-(3,4-dimethylphenyl)sulfinyl]methyl]-5-thiophen-2-yl-1,3-oxazole is Cc1ccc([S@@](=O)Cc2ncc(-c3cccs3)o2)cc1C.
What is the InChIKey of 2-[[(S)-(3,4-dimethylphenyl)sulfinyl]methyl]-5-thiophen-2-yl-1,3-oxazole?
The InChIKey is ZCTUWMMQWLXVMW-NRFANRHFSA-N. The full InChI is InChI=1S/C16H15NO2S2/c1-11-5-6-13(8-12(11)2)21(18)10-16-17-9-14(19-16)15-4-3-7-20-15/h3-9H,10H2,1-2H3/t21-/m0/s1.
What are the key properties of 2-[[(S)-(3,4-dimethylphenyl)sulfinyl]methyl]-5-thiophen-2-yl-1,3-oxazole?
2-[[(S)-(3,4-dimethylphenyl)sulfinyl]methyl]-5-thiophen-2-yl-1,3-oxazole has a molecular weight of 317.44 g/mol, XLogP of 4.33, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(S)-(3,4-dimethylphenyl)sulfinyl]methyl]-5-thiophen-2-yl-1,3-oxazole is sourced from PubChem (CID 97031157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).