C17H16FNO2S — CID 97031637
4-fluoro-N-[[4-[(S)-methylsulfinyl]phenyl]methyl]-2-prop-2-ynoxyaniline (PubChem CID 97031637) has the molecular formula C17H16FNO2S and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-fluoro-N-[[4-[(S)-methylsulfinyl]phenyl]methyl]-2-prop-2-ynoxyaniline.
| Compound Name | 4-fluoro-N-[[4-[(S)-methylsulfinyl]phenyl]methyl]-2-prop-2-ynoxyaniline |
|---|---|
| PubChem CID | 97031637 |
| Molecular Formula | C17H16FNO2S |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 4-fluoro-N-[[4-[(S)-methylsulfinyl]phenyl]methyl]-2-prop-2-ynoxyaniline |
| SMILES | C#CCOc1cc(F)ccc1NCc1ccc([S@](C)=O)cc1 |
| InChI | InChI=1S/C17H16FNO2S/c1-3-10-21-17-11-14(18)6-9-16(17)19-12-13-4-7-15(8-5-13)22(2)20/h1,4-9,11,19H,10,12H2,2H3/t22-/m0/s1 |
| InChIKey | PNSWCMMFCRNTHP-QFIPXVFZSA-N |
| XLogP | 3.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|