C8H19NO — CID 97033653
(2S,5S)-5-amino-4,4-dimethylhexan-2-ol (PubChem CID 97033653) has the molecular formula C8H19NO and a molecular weight of 145.25 g/mol. Its IUPAC name is (2S,5S)-5-amino-4,4-dimethylhexan-2-ol.
| Compound Name | (2S,5S)-5-amino-4,4-dimethylhexan-2-ol |
|---|---|
| PubChem CID | 97033653 |
| Molecular Formula | C8H19NO |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | (2S,5S)-5-amino-4,4-dimethylhexan-2-ol |
| SMILES | C[C@H](O)CC(C)(C)[C@H](C)N |
| InChI | InChI=1S/C8H19NO/c1-6(10)5-8(3,4)7(2)9/h6-7,10H,5,9H2,1-4H3/t6-,7-/m0/s1 |
| InChIKey | MYCFWAVRDQBOEH-BQBZGAKWSA-N |
| XLogP | 1.13 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |