C9H18N2O2 — CID 97035443
2-[(1R,2S)-2-methoxycyclohexyl]acetohydrazide (PubChem CID 97035443) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-[(1R,2S)-2-methoxycyclohexyl]acetohydrazide.
| Compound Name | 2-[(1R,2S)-2-methoxycyclohexyl]acetohydrazide |
|---|---|
| PubChem CID | 97035443 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 2-[(1R,2S)-2-methoxycyclohexyl]acetohydrazide |
| SMILES | CO[C@H]1CCCC[C@@H]1CC(=O)NN |
| InChI | InChI=1S/C9H18N2O2/c1-13-8-5-3-2-4-7(8)6-9(12)11-10/h7-8H,2-6,10H2,1H3,(H,11,12)/t7-,8+/m1/s1 |
| InChIKey | AOLIAENDNQNVER-SFYZADRCSA-N |
| XLogP | 0.57 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|