C9H18N2O2 — CID 93280771
2-[[(1S,2S)-2-methoxycyclohexyl]amino]acetamide (PubChem CID 93280771) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-[[(1S,2S)-2-methoxycyclohexyl]amino]acetamide.
| Compound Name | 2-[[(1S,2S)-2-methoxycyclohexyl]amino]acetamide |
|---|---|
| PubChem CID | 93280771 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 2-[[(1S,2S)-2-methoxycyclohexyl]amino]acetamide |
| SMILES | CO[C@H]1CCCC[C@@H]1NCC(N)=O |
| InChI | InChI=1S/C9H18N2O2/c1-13-8-5-3-2-4-7(8)11-6-9(10)12/h7-8,11H,2-6H2,1H3,(H2,10,12)/t7-,8-/m0/s1 |
| InChIKey | QRBKOPDLEIHDJB-YUMQZZPRSA-N |
| XLogP | 0.02 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |