C12H24N2O2 — CID 62087512
N,N-diethyl-2-[(2-methoxycyclopentyl)amino]acetamide (PubChem CID 62087512) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N,N-diethyl-2-[(2-methoxycyclopentyl)amino]acetamide.
| Compound Name | N,N-diethyl-2-[(2-methoxycyclopentyl)amino]acetamide |
|---|---|
| PubChem CID | 62087512 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N,N-diethyl-2-[(2-methoxycyclopentyl)amino]acetamide |
| SMILES | CCN(CC)C(=O)CNC1CCCC1OC |
| InChI | InChI=1S/C12H24N2O2/c1-4-14(5-2)12(15)9-13-10-7-6-8-11(10)16-3/h10-11,13H,4-9H2,1-3H3 |
| InChIKey | UIFMULQKQAKQJC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |