C11H22N2O2 — CID 115693925
1,1-diethyl-3-(2-methoxycyclopentyl)urea (PubChem CID 115693925) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 1,1-diethyl-3-(2-methoxycyclopentyl)urea.
| Compound Name | 1,1-diethyl-3-(2-methoxycyclopentyl)urea |
|---|---|
| PubChem CID | 115693925 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1,1-diethyl-3-(2-methoxycyclopentyl)urea |
| SMILES | CCN(CC)C(=O)NC1CCCC1OC |
| InChI | InChI=1S/C11H22N2O2/c1-4-13(5-2)11(14)12-9-7-6-8-10(9)15-3/h9-10H,4-8H2,1-3H3,(H,12,14) |
| InChIKey | MEBQOKQZOPCYGV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |