C9H10BrN3S — CID 97035679
(2R)-2-amino-2-(6-bromo-1H-benzimidazol-2-yl)ethanethiol (PubChem CID 97035679) has the molecular formula C9H10BrN3S and a molecular weight of 272.17 g/mol. Its IUPAC name is (2R)-2-amino-2-(6-bromo-1H-benzimidazol-2-yl)ethanethiol.
| Compound Name | (2R)-2-amino-2-(6-bromo-1H-benzimidazol-2-yl)ethanethiol |
|---|---|
| PubChem CID | 97035679 |
| Molecular Formula | C9H10BrN3S |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | (2R)-2-amino-2-(6-bromo-1H-benzimidazol-2-yl)ethanethiol |
| SMILES | N[C@@H](CS)c1nc2ccc(Br)cc2[nH]1 |
| InChI | InChI=1S/C9H10BrN3S/c10-5-1-2-7-8(3-5)13-9(12-7)6(11)4-14/h1-3,6,14H,4,11H2,(H,12,13)/t6-/m0/s1 |
| InChIKey | OZVHVCLGSKOWPE-LURJTMIESA-N |
| XLogP | 2.26 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|