C12H17BrN4 — CID 102547616
1-(6-bromo-1H-benzimidazol-2-yl)pentane-1,5-diamine (PubChem CID 102547616) has the molecular formula C12H17BrN4 and a molecular weight of 297.20 g/mol. Its IUPAC name is 1-(6-bromo-1H-benzimidazol-2-yl)pentane-1,5-diamine.
| Compound Name | 1-(6-bromo-1H-benzimidazol-2-yl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 102547616 |
| Molecular Formula | C12H17BrN4 |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 1-(6-bromo-1H-benzimidazol-2-yl)pentane-1,5-diamine |
| SMILES | NCCCCC(N)c1nc2ccc(Br)cc2[nH]1 |
| InChI | InChI=1S/C12H17BrN4/c13-8-4-5-10-11(7-8)17-12(16-10)9(15)3-1-2-6-14/h4-5,7,9H,1-3,6,14-15H2,(H,16,17) |
| InChIKey | OVGWVLLZWALSRM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|