C32H37N5 — CID 122429553
1-[3-[6-[2-(4-aminobutyl)-3H-benzimidazol-5-yl]naphthalen-2-yl]phenyl]pentane-1,5-diamine (PubChem CID 122429553) has the molecular formula C32H37N5 and a molecular weight of 491.68 g/mol. Its IUPAC name is 1-[3-[6-[2-(4-aminobutyl)-3H-benzimidazol-5-yl]naphthalen-2-yl]phenyl]pentane-1,5-diamine.
| Compound Name | 1-[3-[6-[2-(4-aminobutyl)-3H-benzimidazol-5-yl]naphthalen-2-yl]phenyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 122429553 |
| Molecular Formula | C32H37N5 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | 1-[3-[6-[2-(4-aminobutyl)-3H-benzimidazol-5-yl]naphthalen-2-yl]phenyl]pentane-1,5-diamine |
| SMILES | NCCCCc1nc2ccc(-c3ccc4cc(-c5cccc(C(N)CCCCN)c5)ccc4c3)cc2[nH]1 |
| InChI | InChI=1S/C32H37N5/c33-16-3-1-8-29(35)28-7-5-6-22(20-28)23-10-11-25-19-26(13-12-24(25)18-23)27-14-15-30-31(21-27)37-32(36-30)9-2-4-17-34/h5-7,10-15,18-21,29H,1-4,8-9,16-17,33-35H2,(H,36,37) |
| InChIKey | YMQBOUAHJXRKHL-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|