C16H21ClN4OS — CID 97036906
2-chloro-N-[(1R)-1-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-3-methylbutyl]benzamide (PubChem CID 97036906) has the molecular formula C16H21ClN4OS and a molecular weight of 352.89 g/mol. Its IUPAC name is 2-chloro-N-[(1R)-1-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-3-methylbutyl]benzamide.
| Compound Name | 2-chloro-N-[(1R)-1-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-3-methylbutyl]benzamide |
|---|---|
| PubChem CID | 97036906 |
| Molecular Formula | C16H21ClN4OS |
| Molecular Weight | 352.89 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-chloro-N-[(1R)-1-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-3-methylbutyl]benzamide |
| SMILES | CCn1c([C@@H](CC(C)C)NC(=O)c2ccccc2Cl)n[nH]c1=S |
| InChI | InChI=1S/C16H21ClN4OS/c1-4-21-14(19-20-16(21)23)13(9-10(2)3)18-15(22)11-7-5-6-8-12(11)17/h5-8,10,13H,4,9H2,1-3H3,(H,18,22)(H,20,23)/t13-/m1/s1 |
| InChIKey | WTFFDWARWDIHCW-CYBMUJFWSA-N |
| XLogP | 4.13 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.89 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|