C15H20N4OS2 — CID 51894773
N-[(1R)-3-methyl-1-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)butyl]thiophene-2-carboxamide (PubChem CID 51894773) has the molecular formula C15H20N4OS2 and a molecular weight of 336.49 g/mol. Its IUPAC name is N-[(1R)-3-methyl-1-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)butyl]thiophene-2-carboxamide.
| Compound Name | N-[(1R)-3-methyl-1-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)butyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 51894773 |
| Molecular Formula | C15H20N4OS2 |
| Molecular Weight | 336.49 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[(1R)-3-methyl-1-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)butyl]thiophene-2-carboxamide |
| SMILES | C=CCn1c([C@@H](CC(C)C)NC(=O)c2cccs2)n[nH]c1=S |
| InChI | InChI=1S/C15H20N4OS2/c1-4-7-19-13(17-18-15(19)21)11(9-10(2)3)16-14(20)12-6-5-8-22-12/h4-6,8,10-11H,1,7,9H2,2-3H3,(H,16,20)(H,18,21)/t11-/m1/s1 |
| InChIKey | OVCACJXKQIQFNX-LLVKDONJSA-N |
| XLogP | 3.71 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|