C14H14Cl2N4OS — CID 2959308
2,4-dichloro-N-[1-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]benzamide (PubChem CID 2959308) has the molecular formula C14H14Cl2N4OS and a molecular weight of 357.27 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 2959308 |
| Molecular Formula | C14H14Cl2N4OS |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 2,4-dichloro-N-[1-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]benzamide |
| SMILES | C=CCn1c(C(C)NC(=O)c2ccc(Cl)cc2Cl)n[nH]c1=S |
| InChI | InChI=1S/C14H14Cl2N4OS/c1-3-6-20-12(18-19-14(20)22)8(2)17-13(21)10-5-4-9(15)7-11(10)16/h3-5,7-8H,1,6H2,2H3,(H,17,21)(H,19,22) |
| InChIKey | VSWGXVBHKDNHEM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|