C26H25NO10 — CID 97037742
(5R)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-1-[[(2S)-oxolan-2-yl]methyl]pyrrolidine-2,3-dione (PubChem CID 97037742) has the molecular formula C26H25NO10 and a molecular weight of 511.48 g/mol. Its IUPAC name is (5R)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-1-[[(2S)-oxolan-2-yl]methyl]pyrrolidine-2,3-dione.
| Compound Name | (5R)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-1-[[(2S)-oxolan-2-yl]methyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 97037742 |
| Molecular Formula | C26H25NO10 |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | (5R)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-1-[[(2S)-oxolan-2-yl]methyl]pyrrolidine-2,3-dione |
| SMILES | COc1cc([C@@H]2C(=C(O)c3ccc4c(c3)OCO4)C(=O)C(=O)N2C[C@@H]2CCCO2)c(OC)c2c1OCO2 |
| InChI | InChI=1S/C26H25NO10/c1-31-18-9-15(23(32-2)25-24(18)36-12-37-25)20-19(21(28)13-5-6-16-17(8-13)35-11-34-16)22(29)26(30)27(20)10-14-4-3-7-33-14/h5-6,8-9,14,20,28H,3-4,7,10-12H2,1-2H3/t14-,20+/m0/s1 |
| InChIKey | IVMUAJDKOWPHMT-VBKZILBWSA-N |
| XLogP | 2.76 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|