C24H21NO8 — CID 97037932
(5R)-5-(1,3-benzodioxol-5-yl)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-[[(2S)-oxolan-2-yl]methyl]pyrrolidine-2,3-dione (PubChem CID 97037932) has the molecular formula C24H21NO8 and a molecular weight of 451.43 g/mol. Its IUPAC name is (5R)-5-(1,3-benzodioxol-5-yl)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-[[(2S)-oxolan-2-yl]methyl]pyrrolidine-2,3-dione.
| Compound Name | (5R)-5-(1,3-benzodioxol-5-yl)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-[[(2S)-oxolan-2-yl]methyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 97037932 |
| Molecular Formula | C24H21NO8 |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | (5R)-5-(1,3-benzodioxol-5-yl)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-[[(2S)-oxolan-2-yl]methyl]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(C[C@@H]2CCCO2)[C@H](c2ccc3c(c2)OCO3)C1=C(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H21NO8/c26-22(14-4-6-17-19(9-14)33-12-31-17)20-21(13-3-5-16-18(8-13)32-11-30-16)25(24(28)23(20)27)10-15-2-1-7-29-15/h3-6,8-9,15,21,26H,1-2,7,10-12H2/t15-,21+/m0/s1 |
| InChIKey | OGYFGWSQHNODHE-YCRPNKLZSA-N |
| XLogP | 2.74 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|