C20H20ClNO2 — CID 97042622
(E)-3-(2-chlorophenyl)-N-[[(2R)-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl]methyl]prop-2-enamide (PubChem CID 97042622) has the molecular formula C20H20ClNO2 and a molecular weight of 341.84 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[[(2R)-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[[(2R)-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 97042622 |
| Molecular Formula | C20H20ClNO2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[[(2R)-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)NC[C@@]1(O)CCc2ccccc2C1 |
| InChI | InChI=1S/C20H20ClNO2/c21-18-8-4-3-6-16(18)9-10-19(23)22-14-20(24)12-11-15-5-1-2-7-17(15)13-20/h1-10,24H,11-14H2,(H,22,23)/b10-9+/t20-/m1/s1 |
| InChIKey | GHZPEUZJXLHUDZ-SQUSKLHYSA-N |
| XLogP | 3.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|