About 1-[[(2R)-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl]methyl]-3-(2-phenoxyethyl)urea
1-[[(2R)-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl]methyl]-3-(2-phenoxyethyl)urea (PubChem CID 97042727) has the molecular formula C20H24N2O3
and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-[[(2R)-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl]methyl]-3-(2-phenoxyethyl)urea.
Molecular Properties
| Compound Name | 1-[[(2R)-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl]methyl]-3-(2-phenoxyethyl)urea |
| PubChem CID | 97042727 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-[[(2R)-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl]methyl]-3-(2-phenoxyethyl)urea |
| SMILES | O=C(NCCOc1ccccc1)NC[C@@]1(O)CCc2ccccc2C1 |
| InChI | InChI=1S/C20H24N2O3/c23-19(21-12-13-25-18-8-2-1-3-9-18)22-15-20(24)11-10-16-6-4-5-7-17(16)14-20/h1-9,24H,10-15H2,(H2,21,22,23)/t20-/m1/s1 |
| InChIKey | DJJLAGSKDAZNKQ-HXUWFJFHSA-N |
| XLogP | 2.28 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(2R)-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl]methyl]-3-(2-phenoxyethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(2R)-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl]methyl]-3-(2-phenoxyethyl)urea?
The IUPAC name of 1-[[(2R)-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl]methyl]-3-(2-phenoxyethyl)urea (CID 97042727) is 1-[[(2R)-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl]methyl]-3-(2-phenoxyethyl)urea.
What is the SMILES notation for 1-[[(2R)-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl]methyl]-3-(2-phenoxyethyl)urea?
The canonical SMILES for 1-[[(2R)-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl]methyl]-3-(2-phenoxyethyl)urea is O=C(NCCOc1ccccc1)NC[C@@]1(O)CCc2ccccc2C1.
What is the InChIKey of 1-[[(2R)-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl]methyl]-3-(2-phenoxyethyl)urea?
The InChIKey is DJJLAGSKDAZNKQ-HXUWFJFHSA-N. The full InChI is InChI=1S/C20H24N2O3/c23-19(21-12-13-25-18-8-2-1-3-9-18)22-15-20(24)11-10-16-6-4-5-7-17(16)14-20/h1-9,24H,10-15H2,(H2,21,22,23)/t20-/m1/s1.
What are the key properties of 1-[[(2R)-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl]methyl]-3-(2-phenoxyethyl)urea?
1-[[(2R)-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl]methyl]-3-(2-phenoxyethyl)urea has a molecular weight of 340.42 g/mol, XLogP of 2.28, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(2R)-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl]methyl]-3-(2-phenoxyethyl)urea is sourced from PubChem (CID 97042727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).