C12H14IN3O — CID 97048245
1-[(2R)-1-cyanopropan-2-yl]-3-(4-iodophenyl)-1-methylurea (PubChem CID 97048245) has the molecular formula C12H14IN3O and a molecular weight of 343.17 g/mol. Its IUPAC name is 1-[(2R)-1-cyanopropan-2-yl]-3-(4-iodophenyl)-1-methylurea.
| Compound Name | 1-[(2R)-1-cyanopropan-2-yl]-3-(4-iodophenyl)-1-methylurea |
|---|---|
| PubChem CID | 97048245 |
| Molecular Formula | C12H14IN3O |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 1-[(2R)-1-cyanopropan-2-yl]-3-(4-iodophenyl)-1-methylurea |
| SMILES | C[C@H](CC#N)N(C)C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C12H14IN3O/c1-9(7-8-14)16(2)12(17)15-11-5-3-10(13)4-6-11/h3-6,9H,7H2,1-2H3,(H,15,17)/t9-/m1/s1 |
| InChIKey | JUFHDYZRBGXIKR-SECBINFHSA-N |
| XLogP | 3.06 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|