C12H23NO — CID 97049022
(1S,2S,4R)-4-methyl-2-[(2S)-piperidin-2-yl]cyclohexan-1-ol (PubChem CID 97049022) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (1S,2S,4R)-4-methyl-2-[(2S)-piperidin-2-yl]cyclohexan-1-ol.
| Compound Name | (1S,2S,4R)-4-methyl-2-[(2S)-piperidin-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 97049022 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (1S,2S,4R)-4-methyl-2-[(2S)-piperidin-2-yl]cyclohexan-1-ol |
| SMILES | C[C@@H]1CC[C@H](O)[C@H]([C@@H]2CCCCN2)C1 |
| InChI | InChI=1S/C12H23NO/c1-9-5-6-12(14)10(8-9)11-4-2-3-7-13-11/h9-14H,2-8H2,1H3/t9-,10+,11+,12+/m1/s1 |
| InChIKey | OTTRXXKJZPYVOE-RHYQMDGZSA-N |
| XLogP | 1.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |