C12H23NO — CID 79862786
2,2-dimethyl-5-piperidin-2-ylcyclopentan-1-ol (PubChem CID 79862786) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 2,2-dimethyl-5-piperidin-2-ylcyclopentan-1-ol.
| Compound Name | 2,2-dimethyl-5-piperidin-2-ylcyclopentan-1-ol |
|---|---|
| PubChem CID | 79862786 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2,2-dimethyl-5-piperidin-2-ylcyclopentan-1-ol |
| SMILES | CC1(C)CCC(C2CCCCN2)C1O |
| InChI | InChI=1S/C12H23NO/c1-12(2)7-6-9(11(12)14)10-5-3-4-8-13-10/h9-11,13-14H,3-8H2,1-2H3 |
| InChIKey | CGPFSSRVNWPUJV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |