C8H15BrO3 — CID 97050275
(4R,5R)-5-bromo-4-ethyl-4,5-dihydroxyhexan-3-one (PubChem CID 97050275) has the molecular formula C8H15BrO3 and a molecular weight of 239.11 g/mol. Its IUPAC name is (4R,5R)-5-bromo-4-ethyl-4,5-dihydroxyhexan-3-one.
| Compound Name | (4R,5R)-5-bromo-4-ethyl-4,5-dihydroxyhexan-3-one |
|---|---|
| PubChem CID | 97050275 |
| Molecular Formula | C8H15BrO3 |
| Molecular Weight | 239.11 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | (4R,5R)-5-bromo-4-ethyl-4,5-dihydroxyhexan-3-one |
| SMILES | CCC(=O)[C@](O)(CC)[C@](C)(O)Br |
| InChI | InChI=1S/C8H15BrO3/c1-4-6(10)8(12,5-2)7(3,9)11/h11-12H,4-5H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | IXQNBGWLRPGGJT-JGVFFNPUSA-N |
| XLogP | 1.21 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.11 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|