About (4R,5R)-5-bromo-4-ethyl-4,5-dihydroxyhexan-3-one
(4R,5R)-5-bromo-4-ethyl-4,5-dihydroxyhexan-3-one (PubChem CID 97050275) has the molecular formula C8H15BrO3
and a molecular weight of 239.11 g/mol. Its IUPAC name is (4R,5R)-5-bromo-4-ethyl-4,5-dihydroxyhexan-3-one.
Molecular Properties
| Compound Name | (4R,5R)-5-bromo-4-ethyl-4,5-dihydroxyhexan-3-one |
| PubChem CID | 97050275 |
| Molecular Formula | C8H15BrO3 |
| Molecular Weight | 239.11 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | (4R,5R)-5-bromo-4-ethyl-4,5-dihydroxyhexan-3-one |
| SMILES | CCC(=O)[C@](O)(CC)[C@](C)(O)Br |
| InChI | InChI=1S/C8H15BrO3/c1-4-6(10)8(12,5-2)7(3,9)11/h11-12H,4-5H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | IXQNBGWLRPGGJT-JGVFFNPUSA-N |
| XLogP | 1.21 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.11 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (4R,5R)-5-bromo-4-ethyl-4,5-dihydroxyhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5R)-5-bromo-4-ethyl-4,5-dihydroxyhexan-3-one?
The IUPAC name of (4R,5R)-5-bromo-4-ethyl-4,5-dihydroxyhexan-3-one (CID 97050275) is (4R,5R)-5-bromo-4-ethyl-4,5-dihydroxyhexan-3-one.
What is the SMILES notation for (4R,5R)-5-bromo-4-ethyl-4,5-dihydroxyhexan-3-one?
The canonical SMILES for (4R,5R)-5-bromo-4-ethyl-4,5-dihydroxyhexan-3-one is CCC(=O)[C@](O)(CC)[C@](C)(O)Br.
What is the InChIKey of (4R,5R)-5-bromo-4-ethyl-4,5-dihydroxyhexan-3-one?
The InChIKey is IXQNBGWLRPGGJT-JGVFFNPUSA-N. The full InChI is InChI=1S/C8H15BrO3/c1-4-6(10)8(12,5-2)7(3,9)11/h11-12H,4-5H2,1-3H3/t7-,8+/m0/s1.
What are the key properties of (4R,5R)-5-bromo-4-ethyl-4,5-dihydroxyhexan-3-one?
(4R,5R)-5-bromo-4-ethyl-4,5-dihydroxyhexan-3-one has a molecular weight of 239.11 g/mol, XLogP of 1.21, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5R)-5-bromo-4-ethyl-4,5-dihydroxyhexan-3-one is sourced from PubChem (CID 97050275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).