C9H18O4 — CID 97050418
(4S,5S)-4-ethyl-4,5-dihydroxy-5-methoxyhexan-3-one (PubChem CID 97050418) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is (4S,5S)-4-ethyl-4,5-dihydroxy-5-methoxyhexan-3-one.
| Compound Name | (4S,5S)-4-ethyl-4,5-dihydroxy-5-methoxyhexan-3-one |
|---|---|
| PubChem CID | 97050418 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (4S,5S)-4-ethyl-4,5-dihydroxy-5-methoxyhexan-3-one |
| SMILES | CCC(=O)[C@@](O)(CC)[C@@](C)(O)OC |
| InChI | InChI=1S/C9H18O4/c1-5-7(10)9(12,6-2)8(3,11)13-4/h11-12H,5-6H2,1-4H3/t8-,9-/m0/s1 |
| InChIKey | CQMXSELOKVBEMZ-IUCAKERBSA-N |
| XLogP | 0.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|