C10H16F2N2 — CID 97050475
1-[(1R)-4,4-difluorocyclohex-2-en-1-yl]piperazine (PubChem CID 97050475) has the molecular formula C10H16F2N2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 1-[(1R)-4,4-difluorocyclohex-2-en-1-yl]piperazine.
| Compound Name | 1-[(1R)-4,4-difluorocyclohex-2-en-1-yl]piperazine |
|---|---|
| PubChem CID | 97050475 |
| Molecular Formula | C10H16F2N2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 1-[(1R)-4,4-difluorocyclohex-2-en-1-yl]piperazine |
| SMILES | FC1(F)C=C[C@H](N2CCNCC2)CC1 |
| InChI | InChI=1S/C10H16F2N2/c11-10(12)3-1-9(2-4-10)14-7-5-13-6-8-14/h1,3,9,13H,2,4-8H2/t9-/m0/s1 |
| InChIKey | VDMMNQPJQNABML-VIFPVBQESA-N |
| XLogP | 1.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|