C17H25N7O — CID 97050768
1-[(8R)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3-[(4R)-1-methyl-4,5,6,7-tetrahydroindazol-4-yl]urea (PubChem CID 97050768) has the molecular formula C17H25N7O and a molecular weight of 343.44 g/mol. Its IUPAC name is 1-[(8R)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3-[(4R)-1-methyl-4,5,6,7-tetrahydroindazol-4-yl]urea.
| Compound Name | 1-[(8R)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3-[(4R)-1-methyl-4,5,6,7-tetrahydroindazol-4-yl]urea |
|---|---|
| PubChem CID | 97050768 |
| Molecular Formula | C17H25N7O |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 1-[(8R)-2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3-[(4R)-1-methyl-4,5,6,7-tetrahydroindazol-4-yl]urea |
| SMILES | CCc1nc2n(n1)CCC[C@H]2NC(=O)N[C@@H]1CCCc2c1cnn2C |
| InChI | InChI=1S/C17H25N7O/c1-3-15-21-16-13(7-5-9-24(16)22-15)20-17(25)19-12-6-4-8-14-11(12)10-18-23(14)2/h10,12-13H,3-9H2,1-2H3,(H2,19,20,25)/t12-,13-/m1/s1 |
| InChIKey | ZVIQHPDUUOBDBP-CHWSQXEVSA-N |
| XLogP | 1.79 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |