C10H17N3S — CID 97052582
(2S,3S)-3-methyl-1-pyrimidin-2-ylsulfanylpentan-2-amine (PubChem CID 97052582) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is (2S,3S)-3-methyl-1-pyrimidin-2-ylsulfanylpentan-2-amine.
| Compound Name | (2S,3S)-3-methyl-1-pyrimidin-2-ylsulfanylpentan-2-amine |
|---|---|
| PubChem CID | 97052582 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | (2S,3S)-3-methyl-1-pyrimidin-2-ylsulfanylpentan-2-amine |
| SMILES | CC[C@H](C)[C@H](N)CSc1ncccn1 |
| InChI | InChI=1S/C10H17N3S/c1-3-8(2)9(11)7-14-10-12-5-4-6-13-10/h4-6,8-9H,3,7,11H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | SFKLTUQISSYCQY-DTWKUNHWSA-N |
| XLogP | 1.94 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |