C14H24N2O2 — CID 97053749
(1S)-1-(furan-2-yl)-2-[(1-propylpiperidin-4-yl)amino]ethanol (PubChem CID 97053749) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is (1S)-1-(furan-2-yl)-2-[(1-propylpiperidin-4-yl)amino]ethanol.
| Compound Name | (1S)-1-(furan-2-yl)-2-[(1-propylpiperidin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 97053749 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | (1S)-1-(furan-2-yl)-2-[(1-propylpiperidin-4-yl)amino]ethanol |
| SMILES | CCCN1CCC(NC[C@H](O)c2ccco2)CC1 |
| InChI | InChI=1S/C14H24N2O2/c1-2-7-16-8-5-12(6-9-16)15-11-13(17)14-4-3-10-18-14/h3-4,10,12-13,15,17H,2,5-9,11H2,1H3/t13-/m0/s1 |
| InChIKey | NFQWMNJWUHTNDK-ZDUSSCGKSA-N |
| XLogP | 1.78 |
| TPSA | 48.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |