C18H25N5O3 — CID 97053822
trans-methyl (1R,2R)-2-[[2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetyl]amino]cycloheptane-1-carboxylate (PubChem CID 97053822) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is trans-methyl (1R,2R)-2-[[2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetyl]amino]cycloheptane-1-carboxylate.
| Compound Name | trans-methyl (1R,2R)-2-[[2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetyl]amino]cycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 97053822 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | trans-methyl (1R,2R)-2-[[2-(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetyl]amino]cycloheptane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCCC[C@H]1NC(=O)Cc1nc2nc(C)cc(C)n2n1 |
| InChI | InChI=1S/C18H25N5O3/c1-11-9-12(2)23-18(19-11)21-15(22-23)10-16(24)20-14-8-6-4-5-7-13(14)17(25)26-3/h9,13-14H,4-8,10H2,1-3H3,(H,20,24)/t13-,14-/m1/s1 |
| InChIKey | LLIBAXAQNKJXQX-ZIAGYGMSSA-N |
| XLogP | 1.52 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |