C30H41N5O3 — CID 71211347
methyl (E,5S)-5-cyclopentyl-7-(2,6-diethyl-4-pyridinyl)-2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-3-hydroxyhept-2-enoate (PubChem CID 71211347) has the molecular formula C30H41N5O3 and a molecular weight of 519.69 g/mol. Its IUPAC name is methyl (E,5S)-5-cyclopentyl-7-(2,6-diethyl-4-pyridinyl)-2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-3-hydroxyhept-2-enoate.
| Compound Name | methyl (E,5S)-5-cyclopentyl-7-(2,6-diethyl-4-pyridinyl)-2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-3-hydroxyhept-2-enoate |
|---|---|
| PubChem CID | 71211347 |
| Molecular Formula | C30H41N5O3 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.32 |
| IUPAC Name | methyl (E,5S)-5-cyclopentyl-7-(2,6-diethyl-4-pyridinyl)-2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-3-hydroxyhept-2-enoate |
| SMILES | CCc1cc(CC[C@@H](C/C(O)=C(/Cc2nc3nc(C)cc(C)n3n2)C(=O)OC)C2CCCC2)cc(CC)n1 |
| InChI | InChI=1S/C30H41N5O3/c1-6-24-15-21(16-25(7-2)32-24)12-13-23(22-10-8-9-11-22)17-27(36)26(29(37)38-5)18-28-33-30-31-19(3)14-20(4)35(30)34-28/h14-16,22-23,36H,6-13,17-18H2,1-5H3/b27-26+/t23-/m0/s1 |
| InChIKey | MJZHAYPDYWASAC-YQMJRWHPSA-N |
| XLogP | 5.62 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|