About N-[4-[2-[[(3R,4R)-1-benzyl-4-methylpyrrolidin-3-yl]amino]ethyl]phenyl]acetamide
N-[4-[2-[[(3R,4R)-1-benzyl-4-methylpyrrolidin-3-yl]amino]ethyl]phenyl]acetamide (PubChem CID 97055469) has the molecular formula C22H29N3O
and a molecular weight of 351.49 g/mol. Its IUPAC name is N-[4-[2-[[(3R,4R)-1-benzyl-4-methylpyrrolidin-3-yl]amino]ethyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[2-[[(3R,4R)-1-benzyl-4-methylpyrrolidin-3-yl]amino]ethyl]phenyl]acetamide |
| PubChem CID | 97055469 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | N-[4-[2-[[(3R,4R)-1-benzyl-4-methylpyrrolidin-3-yl]amino]ethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CCN[C@H]2CN(Cc3ccccc3)C[C@H]2C)cc1 |
| InChI | InChI=1S/C22H29N3O/c1-17-14-25(15-20-6-4-3-5-7-20)16-22(17)23-13-12-19-8-10-21(11-9-19)24-18(2)26/h3-11,17,22-23H,12-16H2,1-2H3,(H,24,26)/t17-,22+/m1/s1 |
| InChIKey | NEZSVIVYABPKAG-VGSWGCGISA-N |
| XLogP | 3.30 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-[2-[[(3R,4R)-1-benzyl-4-methylpyrrolidin-3-yl]amino]ethyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[2-[[(3R,4R)-1-benzyl-4-methylpyrrolidin-3-yl]amino]ethyl]phenyl]acetamide?
The IUPAC name of N-[4-[2-[[(3R,4R)-1-benzyl-4-methylpyrrolidin-3-yl]amino]ethyl]phenyl]acetamide (CID 97055469) is N-[4-[2-[[(3R,4R)-1-benzyl-4-methylpyrrolidin-3-yl]amino]ethyl]phenyl]acetamide.
What is the SMILES notation for N-[4-[2-[[(3R,4R)-1-benzyl-4-methylpyrrolidin-3-yl]amino]ethyl]phenyl]acetamide?
The canonical SMILES for N-[4-[2-[[(3R,4R)-1-benzyl-4-methylpyrrolidin-3-yl]amino]ethyl]phenyl]acetamide is CC(=O)Nc1ccc(CCN[C@H]2CN(Cc3ccccc3)C[C@H]2C)cc1.
What is the InChIKey of N-[4-[2-[[(3R,4R)-1-benzyl-4-methylpyrrolidin-3-yl]amino]ethyl]phenyl]acetamide?
The InChIKey is NEZSVIVYABPKAG-VGSWGCGISA-N. The full InChI is InChI=1S/C22H29N3O/c1-17-14-25(15-20-6-4-3-5-7-20)16-22(17)23-13-12-19-8-10-21(11-9-19)24-18(2)26/h3-11,17,22-23H,12-16H2,1-2H3,(H,24,26)/t17-,22+/m1/s1.
What are the key properties of N-[4-[2-[[(3R,4R)-1-benzyl-4-methylpyrrolidin-3-yl]amino]ethyl]phenyl]acetamide?
N-[4-[2-[[(3R,4R)-1-benzyl-4-methylpyrrolidin-3-yl]amino]ethyl]phenyl]acetamide has a molecular weight of 351.49 g/mol, XLogP of 3.30, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[2-[[(3R,4R)-1-benzyl-4-methylpyrrolidin-3-yl]amino]ethyl]phenyl]acetamide is sourced from PubChem (CID 97055469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).