C16H26N2 — CID 97321645
(3R,4R)-1-ethyl-3-methyl-N-(2-phenylethyl)piperidin-4-amine (PubChem CID 97321645) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is (3R,4R)-1-ethyl-3-methyl-N-(2-phenylethyl)piperidin-4-amine.
| Compound Name | (3R,4R)-1-ethyl-3-methyl-N-(2-phenylethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 97321645 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | (3R,4R)-1-ethyl-3-methyl-N-(2-phenylethyl)piperidin-4-amine |
| SMILES | CCN1CC[C@@H](NCCc2ccccc2)[C@H](C)C1 |
| InChI | InChI=1S/C16H26N2/c1-3-18-12-10-16(14(2)13-18)17-11-9-15-7-5-4-6-8-15/h4-8,14,16-17H,3,9-13H2,1-2H3/t14-,16-/m1/s1 |
| InChIKey | BNVNLKYMMXQHAV-GDBMZVCRSA-N |
| XLogP | 2.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |