C15H21N3O3 — CID 97056526
tert-butyl N-[(2S)-2-amino-2-(4-hydroxy-1H-indol-5-yl)ethyl]carbamate (PubChem CID 97056526) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-amino-2-(4-hydroxy-1H-indol-5-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-amino-2-(4-hydroxy-1H-indol-5-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 97056526 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | tert-butyl N-[(2S)-2-amino-2-(4-hydroxy-1H-indol-5-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](N)c1ccc2[nH]ccc2c1O |
| InChI | InChI=1S/C15H21N3O3/c1-15(2,3)21-14(20)18-8-11(16)9-4-5-12-10(13(9)19)6-7-17-12/h4-7,11,17,19H,8,16H2,1-3H3,(H,18,20)/t11-/m1/s1 |
| InChIKey | MJLVYSAKLJAXHL-LLVKDONJSA-N |
| XLogP | 2.40 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|