C12H15N3O — CID 97056927
(3R)-3-(1H-pyrrolo[3,2-b]pyridin-5-yl)piperidin-3-ol (PubChem CID 97056927) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is (3R)-3-(1H-pyrrolo[3,2-b]pyridin-5-yl)piperidin-3-ol.
| Compound Name | (3R)-3-(1H-pyrrolo[3,2-b]pyridin-5-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 97056927 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | (3R)-3-(1H-pyrrolo[3,2-b]pyridin-5-yl)piperidin-3-ol |
| SMILES | O[C@]1(c2ccc3[nH]ccc3n2)CCCNC1 |
| InChI | InChI=1S/C12H15N3O/c16-12(5-1-6-13-8-12)11-3-2-9-10(15-11)4-7-14-9/h2-4,7,13-14,16H,1,5-6,8H2/t12-/m1/s1 |
| InChIKey | RUHQBFAOBLGLGF-GFCCVEGCSA-N |
| XLogP | 1.13 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |