C8H7Cl2N5 — CID 97057710
2-(3,5-dichloro-2-pyridinyl)-5-methyltriazol-4-amine (PubChem CID 97057710) has the molecular formula C8H7Cl2N5 and a molecular weight of 244.09 g/mol. Its IUPAC name is 2-(3,5-dichloro-2-pyridinyl)-5-methyltriazol-4-amine.
| Compound Name | 2-(3,5-dichloro-2-pyridinyl)-5-methyltriazol-4-amine |
|---|---|
| PubChem CID | 97057710 |
| Molecular Formula | C8H7Cl2N5 |
| Molecular Weight | 244.09 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 2-(3,5-dichloro-2-pyridinyl)-5-methyltriazol-4-amine |
| SMILES | Cc1nn(-c2ncc(Cl)cc2Cl)nc1N |
| InChI | InChI=1S/C8H7Cl2N5/c1-4-7(11)14-15(13-4)8-6(10)2-5(9)3-12-8/h2-3H,1H3,(H2,11,14) |
| InChIKey | QFBYDQXXBVRQSR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.09 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |