C7H4Cl2N4 — CID 131020565
3,5-dichloro-2-(1,2,4-triazol-4-yl)pyridine (PubChem CID 131020565) has the molecular formula C7H4Cl2N4 and a molecular weight of 215.04 g/mol. Its IUPAC name is 3,5-dichloro-2-(1,2,4-triazol-4-yl)pyridine.
| Compound Name | 3,5-dichloro-2-(1,2,4-triazol-4-yl)pyridine |
|---|---|
| PubChem CID | 131020565 |
| Molecular Formula | C7H4Cl2N4 |
| Molecular Weight | 215.04 g/mol |
| Exact Mass | 213.98 |
| IUPAC Name | 3,5-dichloro-2-(1,2,4-triazol-4-yl)pyridine |
| SMILES | Clc1cnc(-n2cnnc2)c(Cl)c1 |
| InChI | InChI=1S/C7H4Cl2N4/c8-5-1-6(9)7(10-2-5)13-3-11-12-4-13/h1-4H |
| InChIKey | TYIZFVBUXCPWSP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.04 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |