C18H23N3O3 — CID 97058450
methyl 5-[(1S)-1-[4-(pyridin-4-ylmethyl)piperazin-1-yl]ethyl]furan-2-carboxylate (PubChem CID 97058450) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is methyl 5-[(1S)-1-[4-(pyridin-4-ylmethyl)piperazin-1-yl]ethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(1S)-1-[4-(pyridin-4-ylmethyl)piperazin-1-yl]ethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 97058450 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | methyl 5-[(1S)-1-[4-(pyridin-4-ylmethyl)piperazin-1-yl]ethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc([C@H](C)N2CCN(Cc3ccncc3)CC2)o1 |
| InChI | InChI=1S/C18H23N3O3/c1-14(16-3-4-17(24-16)18(22)23-2)21-11-9-20(10-12-21)13-15-5-7-19-8-6-15/h3-8,14H,9-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | XOPYIKRKJUVNRX-AWEZNQCLSA-N |
| XLogP | 2.34 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |